![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | cover.jpg | 2023-10-20 23:21 | 53K | |
![[SND]](/icons/sound2.gif) | 21. Nihilist (D.E.).mp3 | 2023-11-22 03:09 | 12M | |
![[SND]](/icons/sound2.gif) | 20. Ascension (Reprise).mp3 | 2023-11-22 03:09 | 7.5M | |
![[SND]](/icons/sound2.gif) | 19. Resonance.mp3 | 2023-11-22 03:09 | 4.9M | |
![[SND]](/icons/sound2.gif) | 18. Event Horizon.mp3 | 2023-11-22 03:09 | 3.3M | |
![[SND]](/icons/sound2.gif) | 17. Catalyst.mp3 | 2023-11-22 03:09 | 5.8M | |
![[SND]](/icons/sound2.gif) | 16. Border Worlds.mp3 | 2023-11-22 03:09 | 4.0M | |
![[SND]](/icons/sound2.gif) | 15. Limitless Potential.mp3 | 2023-11-22 03:09 | 5.2M | |
![[SND]](/icons/sound2.gif) | 14. Respite (D.E.).mp3 | 2023-11-22 03:09 | 3.9M | |
![[SND]](/icons/sound2.gif) | 13. Ascension (D.E.).mp3 | 2023-11-22 03:09 | 7.5M | |
![[SND]](/icons/sound2.gif) | 12. Critical Mass.mp3 | 2023-11-22 03:09 | 4.9M | |
![[SND]](/icons/sound2.gif) | 11. Harbinger (D.E.).mp3 | 2023-11-22 03:09 | 6.3M | |
![[SND]](/icons/sound2.gif) | 10. Interloper.mp3 | 2023-11-22 03:09 | 4.0M | |
![[SND]](/icons/sound2.gif) | 09. Shadows Of Death (D.E.).mp3 | 2023-11-22 03:09 | 6.0M | |
![[SND]](/icons/sound2.gif) | 08. Mind Games.mp3 | 2023-10-20 23:24 | 2.8M | |
![[SND]](/icons/sound2.gif) | 07. Lair.mp3 | 2023-11-22 03:09 | 8.9M | |
![[SND]](/icons/sound2.gif) | 06. The Hunting (D.E.).mp3 | 2023-11-22 03:09 | 6.7M | |
![[SND]](/icons/sound2.gif) | 05. Alien.mp3 | 2023-11-22 03:09 | 7.0M | |
![[SND]](/icons/sound2.gif) | 04. Convergence.mp3 | 2023-11-22 03:09 | 4.6M | |
![[SND]](/icons/sound2.gif) | 03. Entangled.mp3 | 2023-10-20 23:24 | 4.0M | |
![[SND]](/icons/sound2.gif) | 02. Internal Conflict.mp3 | 2023-11-22 03:09 | 6.6M | |
![[SND]](/icons/sound2.gif) | 01. Transcendent.mp3 | 2023-11-22 03:09 | 3.7M | |
|